|
CAS#: 59173-25-0 Product: N-Ethyl-1-[3-(trifluoromethylsulfanyl)phenyl]propan-2-amine No suppilers available for the product. |
| Name | N-Ethyl-1-[3-(trifluoromethylsulfanyl)phenyl]propan-2-amine |
|---|---|
| Synonyms | N-Ethyl-1-[3-(Trifluoromethylthio)Phenyl]Propan-2-Amine; Ethyl-[1-Methyl-2-[3-(Trifluoromethylthio)Phenyl]Ethyl]Amine; Sl-72340-D |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.32 |
| CAS Registry Number | 59173-25-0 |
| SMILES | C1=C(CC(NCC)C)C=CC=C1SC(F)(F)F |
| InChI | 1S/C12H16F3NS/c1-3-16-9(2)7-10-5-4-6-11(8-10)17-12(13,14)15/h4-6,8-9,16H,3,7H2,1-2H3 |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.899°C at 760 mmHg (Cal.) |
| Flash point | 104.331°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Ethyl-1-[3-(trifluoromethylsulfanyl)phenyl]propan-2-amine |