Online Database of Chemicals from Around the World
|
CAS#: 59200-49-6 Product: 1,1'-(Methylethanediylidenedinitrilo)bis(3-aminoguanidine) No suppilers available for the product. |
| Name | 1,1'-(Methylethanediylidenedinitrilo)bis(3-aminoguanidine) |
|---|---|
| Synonyms | 1,1'-(Methylethanediylidenedinitrilo) bis (3-aminoguanidine); 1,1'-(Methylethanediylidenedinitrilo)bis(3-aminoguanidine) |
| Molecular Structure |  |
| Molecular Formula | C5H14N10 |
| Molecular Weight | 214.23 |
| CAS Registry Number | 59200-49-6 |
| SMILES | N(/N/C(=N\N)N)=C\C(=N\NC(=NN)N)C |
| InChI | 1S/C5H14N10/c1-3(13-15-5(7)12-9)2-10-14-4(6)11-8/h2H,8-9H2,1H3,(H3,6,11,14)(H3,7,12,15)/b10-2+,13-3+ |
| InChIKey | OJYUJZDMEIWZLQ-GMWIKGNHSA-N |
| Density | 1.678g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.233°C at 760 mmHg (Cal.) |
| Flash point | 234.56°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(Methylethanediylidenedinitrilo)bis(3-aminoguanidine) |