|
CAS#: 59232-87-0 Product: Rifamycin P No suppilers available for the product. |
| Name | Rifamycin P |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C38H46N2O11S |
| Molecular Weight | 738.85 |
| CAS Registry Number | 59232-87-0 |
| SMILES | C1=NC4=C(S1)C2=C(O)C5=C(O)C(=C3OC(O\C=C/C(OC)C(C(OC(=O)C)C(C(O)C(C(O)C(\C=C\C=C(C(=O)N2)/C)C)C)C)C)(C(=O)C3=C45)C)C |
| InChI | 1S/C38H46N2O11S/c1-16-11-10-12-17(2)37(47)40-28-32(45)25-24(27-35(28)52-15-39-27)26-34(21(6)31(25)44)51-38(8,36(26)46)49-14-13-23(48-9)18(3)33(50-22(7)41)20(5)30(43)19(4)29(16)42/h10-16,18-20,23,29-30,33,42-45H,1-9H3,(H,40,47)/b11-10+,14-13-,17-12+ |
| InChIKey | XTPGUQSTSWYULT-TXXBDZDDSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 934.296°C at 760 mmHg (Cal.) |
| Flash point | 518.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Rifamycin P |