Online Database of Chemicals from Around the World
|
CAS#: 59340-47-5 Product: Dimethyl 4-Iodophthalate No suppilers available for the product. |
| Name | Dimethyl 4-Iodophthalate |
|---|---|
| Synonyms | 4-Iodobenzene-1,2-Dicarboxylic Acid Dimethyl Ester; Dimethyl 4-Iodophthalate |
| Molecular Structure |  |
| Molecular Formula | C10H9IO4 |
| Molecular Weight | 320.08 |
| CAS Registry Number | 59340-47-5 |
| EINECS | 261-711-1 |
| SMILES | C1=C(C(=CC(=C1)I)C(=O)OC)C(=O)OC |
| InChI | 1S/C10H9IO4/c1-14-9(12)7-4-3-6(11)5-8(7)10(13)15-2/h3-5H,1-2H3 |
| InChIKey | JVLGGEVUYARXHI-UHFFFAOYSA-N |
| Density | 1.709g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.437°C at 760 mmHg (Cal.) |
| Flash point | 153.643°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4-Iodophthalate |