|
CAS#: 59417-86-6 Product: 6-Fluorobenzo(a)Pyrene No suppilers available for the product. |
| Name | 6-Fluorobenzo(a)Pyrene |
|---|---|
| Synonyms | Nsc273823; 6-Fluorobenzo(A)Pyrene; Benzo(A)Pyrene, 6-Fluoro- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H11F |
| Molecular Weight | 270.31 |
| CAS Registry Number | 59417-86-6 |
| SMILES | C2=C4C3=C1C(=CC=CC1=C2)C=CC3=C5C(=C4F)C=CC=C5 |
| InChI | 1S/C20H11F/c21-20-16-7-2-1-6-14(16)15-10-8-12-4-3-5-13-9-11-17(20)19(15)18(12)13/h1-11H |
| InChIKey | WELROXOUKNZNRH-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.384°C at 760 mmHg (Cal.) |
| Flash point | 203.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Fluorobenzo(a)Pyrene |