|
CAS#: 59465-55-3 Product: 2,4,6-Trimethylphenyl(Imino)Imidazolidine No suppilers available for the product. |
| Name | 2,4,6-Trimethylphenyl(Imino)Imidazolidine |
|---|---|
| Synonyms | [1-(2,4,6-Trimethylphenyl)-4,5-Dihydroimidazol-2-Yl]Amine; 2,4,6-Trimethylphenyl(Imino)Imidazolidine; Benzenamine, N-2-Imidazolidinylidene-2,4,6-Trimethyl-, Monohydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 |
| CAS Registry Number | 59465-55-3 |
| SMILES | C1=C(C=C(C(=C1C)N2CCN=C2N)C)C |
| InChI | 1S/C12H17N3/c1-8-6-9(2)11(10(3)7-8)15-5-4-14-12(15)13/h6-7H,4-5H2,1-3H3,(H2,13,14) |
| InChIKey | XQYQYDREBUDCIM-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.934°C at 760 mmHg (Cal.) |
| Flash point | 163.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trimethylphenyl(Imino)Imidazolidine |