|
CAS#: 5949-46-2 Product: 14-Hydroxyestrone No suppilers available for the product. |
| Name | 14-Hydroxyestrone |
|---|---|
| Synonyms | 14-Hydroxyestrone; Estra-1,3,5(10)-Trien-17-One, 3,14-Dihydroxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 |
| CAS Registry Number | 5949-46-2 |
| SMILES | [C@@H]23CCC1=C(C=CC(=C1)O)[C@H]2CC[C@]4(C3(CCC4=O)O)C |
| InChI | 1S/C18H22O3/c1-17-8-6-14-13-4-3-12(19)10-11(13)2-5-15(14)18(17,21)9-7-16(17)20/h3-4,10,14-15,19,21H,2,5-9H2,1H3/t14-,15-,17-,18?/m1/s1 |
| InChIKey | AEJPUEILJPVYOZ-MWPGWRTMSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.473°C at 760 mmHg (Cal.) |
| Flash point | 261.51°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 14-Hydroxyestrone |