|
CAS#: 5954-10-9 Product: Phosphorothioic Acid O,O-Diethyl S-(Pentachlorophenyl) Ester No suppilers available for the product. |
| Name | Phosphorothioic Acid O,O-Diethyl S-(Pentachlorophenyl) Ester |
|---|---|
| Synonyms | 1,2,3,4,5-Pentachloro-6-Diethoxyphosphorylsulfanyl-Benzene; 1,2,3,4,5-Pentachloro-6-(Diethoxyphosphorylthio)Benzene; Phosphorothioic Acid, O,O-Diethyl S-Pentachlorophenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl5O3PS |
| Molecular Weight | 418.49 |
| CAS Registry Number | 5954-10-9 |
| SMILES | C(O[P](SC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)(=O)OCC)C |
| InChI | 1S/C10H10Cl5O3PS/c1-3-17-19(16,18-4-2)20-10-8(14)6(12)5(11)7(13)9(10)15/h3-4H2,1-2H3 |
| InChIKey | PFQVWSAUKWVGGW-UHFFFAOYSA-N |
| Density | 1.589g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.782°C at 760 mmHg (Cal.) |
| Flash point | 217.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphorothioic Acid O,O-Diethyl S-(Pentachlorophenyl) Ester |