|
CAS#: 5959-82-0 Product: Dehydroerythorbic Acid No suppilers available for the product. |
| Name | Dehydroerythorbic Acid |
|---|---|
| Synonyms | (5R)-5-[(1R)-1,2-Dihydroxyethyl]Tetrahydrofuran-2,3,4-Trione; D-Erythro-2,3-Hexodiulosonic Acid, Gamma-Lactone; Dehydroerythorbic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 |
| CAS Registry Number | 5959-82-0 |
| SMILES | [C@@H]1([C@H](O)CO)C(C(C(=O)O1)=O)=O |
| InChI | 1S/C6H6O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8H,1H2/t2-,5-/m1/s1 |
| InChIKey | SBJKKFFYIZUCET-DUZGATOHSA-N |
| Density | 1.743g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.254°C at 760 mmHg (Cal.) |
| Flash point | 170.016°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydroerythorbic Acid |