|
CAS#: 596-28-1 Product: 3,3-Bis(3,4-Dihydroxyphenyl)Isobenzofuran-1(3H)-One No suppilers available for the product. |
| Name | 3,3-Bis(3,4-Dihydroxyphenyl)Isobenzofuran-1(3H)-One |
|---|---|
| Synonyms | 3,3-Bis(3,4-Dihydroxyphenyl)Isobenzofuran-1-One; 3,3-Bis(3,4-Dihydroxyphenyl)-1-Isobenzofuranone; 1(3H)-Isobenzofuranone, 3,3-Bis(3,4-Dihydroxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 |
| CAS Registry Number | 596-28-1 |
| SMILES | C1=CC4=C(C=C1)C(C2=CC=C(C(=C2)O)O)(C3=CC=C(C(=C3)O)O)OC4=O |
| InChI | 1S/C20H14O6/c21-15-7-5-11(9-17(15)23)20(12-6-8-16(22)18(24)10-12)14-4-2-1-3-13(14)19(25)26-20/h1-10,21-24H |
| InChIKey | QPFLFTVMWJJXKU-UHFFFAOYSA-N |
| Density | 1.546g/cm3 (Cal.) |
|---|---|
| Boiling point | 658.729°C at 760 mmHg (Cal.) |
| Flash point | 243.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Bis(3,4-Dihydroxyphenyl)Isobenzofuran-1(3H)-One |