|
CAS#: 596-69-0 Product: 18-Hydroxyprogesterone No suppilers available for the product. |
| Name | 18-Hydroxyprogesterone |
|---|---|
| Synonyms | (8R,9S,10R,13R,14S,17S)-17-Acetyl-10-Methyl-13-Methylol-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; (8R,9S,10R,13R,14S,17S)-17-Ethanoyl-13-(Hydroxymethyl)-10-Methyl-1,2,6,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 |
| CAS Registry Number | 596-69-0 |
| EINECS | 209-889-1 |
| SMILES | [C@@]14(CO)[C@H]([C@H]3[C@H](CC1)[C@]2(C)C(=CC(CC2)=O)CC3)CC[C@@H]4C(C)=O |
| InChI | 1S/C21H30O3/c1-13(23)17-5-6-19-16-4-3-14-11-15(24)7-9-20(14,2)18(16)8-10-21(17,19)12-22/h11,16-19,22H,3-10,12H2,1-2H3/t16-,17-,18+,19+,20+,21+/m1/s1 |
| InChIKey | QFNCSEWPJSDMED-OFELHODLSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.364°C at 760 mmHg (Cal.) |
| Flash point | 266.276°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 18-Hydroxyprogesterone |