|
CAS#: 5964-56-7 Product: Isopentyl(1,5-Dimethylhexyl)Ammonium Chloride No suppilers available for the product. |
| Name | Isopentyl(1,5-Dimethylhexyl)Ammonium Chloride |
|---|---|
| Synonyms | N-Isopentyl-6-Methyl-Heptan-2-Amine Hydrochloride; N-Isopentyl-6-Methylheptan-2-Amine Hydrochloride; 1,5-Dimethylhexyl-Isoamyl-Amine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H30ClN |
| Molecular Weight | 235.84 |
| CAS Registry Number | 5964-56-7 |
| EINECS | 227-745-6 |
| SMILES | [H+].C(C(NCCC(C)C)C)CCC(C)C.[Cl-] |
| InChI | 1S/C13H29N.ClH/c1-11(2)7-6-8-13(5)14-10-9-12(3)4;/h11-14H,6-10H2,1-5H3;1H |
| InChIKey | LOUVMIYRBQFBQN-UHFFFAOYSA-N |
| Boiling point | 229.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 72.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopentyl(1,5-Dimethylhexyl)Ammonium Chloride |