| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2-Bromo-3,3,4,4,5,5,6,6,6-Nonafluoro-1-Hexene |
|---|---|
| Synonyms | 2-BROMO-2-(PERFLUORO-N-BUTYL)ETHYLENE; 2-Bromo-3,3,4,4,5,5,6,6,6-nonafluoro-1-hexene; 2-Bromo-3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
| Molecular Structure | ![]() |
| Molecular Formula | C6H2BrF9 |
| Molecular Weight | 324.97 |
| CAS Registry Number | 59665-23-5 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C(Br)=C |
| InChI | 1S/C6H2BrF9/c1-2(7)3(8,9)4(10,11)5(12,13)6(14,15)16/h1H2 |
| InChIKey | KSQRGPQLCIXCCL-UHFFFAOYSA-N |
| Density | 1.758g/cm3 (Cal.) |
|---|---|
| Boiling point | 118.263°C at 760 mmHg (Cal.) |
| Flash point | 25.325°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-3,3,4,4,5,5,6,6,6-Nonafluoro-1-Hexene |