Online Database of Chemicals from Around the World
|
CAS#: 597-88-6 Product: Isoparathion No suppilers available for the product. |
| Name | Isoparathion |
|---|---|
| Synonyms | 1-(Ethoxy-Ethylsulfanyl-Phosphoryl)Oxy-4-Nitro-Benzene; 1-[Ethoxy-(Ethylthio)Phosphoryl]Oxy-4-Nitrobenzene; 1-[Ethoxy-(Ethylthio)Phosphoryl]Oxy-4-Nitro-Benzene |
| Molecular Structure |  |
| Molecular Formula | C10H14NO5PS |
| Molecular Weight | 291.26 |
| CAS Registry Number | 597-88-6 |
| SMILES | C1=CC(=CC=C1O[P](OCC)(=O)SCC)[N+]([O-])=O |
| InChI | 1S/C10H14NO5PS/c1-3-15-17(14,18-4-2)16-10-7-5-9(6-8-10)11(12)13/h5-8H,3-4H2,1-2H3 |
| InChIKey | BGWJTLLALYACOG-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.664°C at 760 mmHg (Cal.) |
| Flash point | 193.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isoparathion |