|
CAS#: 59708-16-6 Product: 1-(4-Trifluoromethylphenyl)-3,3-Dimethyltriazene No suppilers available for the product. |
| Name | 1-(4-Trifluoromethylphenyl)-3,3-Dimethyltriazene |
|---|---|
| Synonyms | N-Methyl-N-[4-(Trifluoromethyl)Phenyl]Azo-Methanamine; N-Methyl-N-[4-(Trifluoromethyl)Phenyl]Azomethanamine; Dimethyl-[4-(Trifluoromethyl)Phenyl]Azo-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 |
| CAS Registry Number | 59708-16-6 |
| SMILES | C1=CC(=CC=C1N=NN(C)C)C(F)(F)F |
| InChI | 1S/C9H10F3N3/c1-15(2)14-13-8-5-3-7(4-6-8)9(10,11)12/h3-6H,1-2H3 |
| InChIKey | GAHZSIUOAYYZPO-UHFFFAOYSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 223.179°C at 760 mmHg (Cal.) |
| Flash point | 88.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Trifluoromethylphenyl)-3,3-Dimethyltriazene |