|
CAS#: 5972-76-9 Product: Ammonium Octanoate No suppilers available for the product. |
| Name | Ammonium Octanoate |
|---|---|
| Synonyms | Ammonium Octanoate; Ammonium Caprylate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 |
| CAS Registry Number | 5972-76-9 |
| EINECS | 227-765-5 |
| SMILES | C(CCCC([O-])=O)CCC.[NH4+] |
| InChI | 1S/C8H16O2.H3N/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);1H3 |
| InChIKey | GEWYFWXMYWWLHW-UHFFFAOYSA-N |
| Boiling point | 239.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium Octanoate |