|
CAS#: 59742-39-1 Product: 1-Isopropyl-3,3A,6-Trimethyl-2,3,3A,4-Tetrahydro-1H-Indene No suppilers available for the product. |
| Name | 1-Isopropyl-3,3A,6-Trimethyl-2,3,3A,4-Tetrahydro-1H-Indene |
|---|---|
| Synonyms | 1-Isopropyl-3,3a,6-trimethyl-2,3,3a,4-tetrahydro-1H-indene #; cascarilladiene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 59742-39-1 |
| SMILES | C\1=C(\C=C2/C(C/1)(C)C(CC2C(C)C)C)C |
| InChI | 1S/C15H24/c1-10(2)13-9-12(4)15(5)7-6-11(3)8-14(13)15/h6,8,10,12-13H,7,9H2,1-5H3 |
| InChIKey | IVBZYUKCNLJUDA-UHFFFAOYSA-N |
| Density | 0.9g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.791°C at 760 mmHg (Cal.) |
| Flash point | 104.146°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isopropyl-3,3A,6-Trimethyl-2,3,3A,4-Tetrahydro-1H-Indene |