|
CAS#: 59743-08-7 Product: Diethyl dioxosuccinate No suppilers available for the product. |
| Name | Diethyl dioxosuccinate |
|---|---|
| Synonyms | 2,3-Dioxobutanedioic Acid Diethyl Ester; 2,3-Diketosuccinic Acid Diethyl Ester; Nsc97398 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 |
| CAS Registry Number | 59743-08-7 |
| SMILES | C(C)OC(=O)C(=O)C(=O)C(=O)OCC |
| InChI | 1S/C8H10O6/c1-3-13-7(11)5(9)6(10)8(12)14-4-2/h3-4H2,1-2H3 |
| InChIKey | HYFOWJVQCLIAIO-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.34°C at 760 mmHg (Cal.) |
| Flash point | 117.374°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl dioxosuccinate |