Online Database of Chemicals from Around the World
|
CAS#: 5980-01-8 Product: Methyl (15beta)-20-Hydroxy-2,16-Didehydrocuran-17-Oate No suppilers available for the product. |
| Name | Methyl (15beta)-20-Hydroxy-2,16-Didehydrocuran-17-Oate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 |
| CAS Registry Number | 5980-01-8 |
| SMILES | O=C(OC)/C4=C2\Nc1ccccc1[C@@]23CCN5[C@H]3C[C@H]4[C@@](O)(CC)C5 |
| InChI | 1S/C20H24N2O3/c1-3-19(24)11-22-9-8-20-12-6-4-5-7-14(12)21-17(20)16(18(23)25-2)13(19)10-15(20)22/h4-7,13,15,21,24H,3,8-11H2,1-2H3/t13-,15+,19-,20-/m1/s1 |
| InChIKey | DGKIJZKKTDPACC-CTNSEHHHSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.698°C at 760 mmHg (Cal.) |
| Flash point | 260.847°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (15beta)-20-Hydroxy-2,16-Didehydrocuran-17-Oate |