|
CAS#: 59832-12-1 Product: 1-Nitro-1-Methyl-2-Naphtylethene No suppilers available for the product. |
| Name | 1-Nitro-1-Methyl-2-Naphtylethene |
|---|---|
| Synonyms | 2-[(E)-2-Nitroprop-1-Enyl]Naphthalene; Nsc121155 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 |
| CAS Registry Number | 59832-12-1 |
| SMILES | C2=CC1=CC=CC=C1C=C2\C=C(/C)[N+]([O-])=O |
| InChI | 1S/C13H11NO2/c1-10(14(15)16)8-11-6-7-12-4-2-3-5-13(12)9-11/h2-9H,1H3/b10-8+ |
| InChIKey | DTZVIBZSHDZFPP-CSKARUKUSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.558°C at 760 mmHg (Cal.) |
| Flash point | 178.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-1-Methyl-2-Naphtylethene |