Online Database of Chemicals from Around the World
|
CAS#: 59866-72-7 Product: 2,2,2-Tribromo-1-Chloroethyl 2,3-Dibromopropionate No suppilers available for the product. |
| Name | 2,2,2-Tribromo-1-Chloroethyl 2,3-Dibromopropionate |
|---|---|
| Synonyms | (2,2,2-Tribromo-1-Chloro-Ethyl) 2,3-Dibromopropanoate; 2,3-Dibromopropanoic Acid (2,2,2-Tribromo-1-Chloroethyl) Ester; 2,3-Dibromopropionic Acid (2,2,2-Tribromo-1-Chloro-Ethyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C5H4Br5ClO2 |
| Molecular Weight | 531.06 |
| CAS Registry Number | 59866-72-7 |
| EINECS | 261-965-3 |
| SMILES | C(C(C(OC(C(Br)(Br)Br)Cl)=O)Br)Br |
| InChI | 1S/C5H4Br5ClO2/c6-1-2(7)3(12)13-4(11)5(8,9)10/h2,4H,1H2 |
| InChIKey | NGCYKKQMUGJOQS-UHFFFAOYSA-N |
| Density | 2.757g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.282°C at 760 mmHg (Cal.) |
| Flash point | 197.698°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Tribromo-1-Chloroethyl 2,3-Dibromopropionate |