Online Database of Chemicals from Around the World
|
CAS#: 59918-44-4 Product: 3,5-Di(2-Furanyl)-4H-1,2,4-Triazole-4-Amine No suppilers available for the product. |
| Name | 3,5-Di(2-Furanyl)-4H-1,2,4-Triazole-4-Amine |
|---|---|
| Synonyms | 3,5-Bis(2-Furyl)-1,2,4-Triazol-4-Amine; [3,5-Bis(2-Furyl)-1,2,4-Triazol-4-Yl]Amine; 0-27-00-00790 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 |
| CAS Registry Number | 59918-44-4 |
| SMILES | C3=C(C1=NN=C([N]1N)C2=CC=CO2)OC=C3 |
| InChI | 1S/C10H8N4O2/c11-14-9(7-3-1-5-15-7)12-13-10(14)8-4-2-6-16-8/h1-6H,11H2 |
| InChIKey | PHTBIIMLGLUUFZ-UHFFFAOYSA-N |
| Density | 1.566g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.79°C at 760 mmHg (Cal.) |
| Flash point | 225.221°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Di(2-Furanyl)-4H-1,2,4-Triazole-4-Amine |