|
CAS#: 59954-01-7 Product: Methyl (2-{4-[2-Hydroxy-3-(Isopropylamino)Propoxy]Phenyl}Ethyl)Carbamate Sulfate (2:1) No suppilers available for the product. |
| Name | Methyl (2-{4-[2-Hydroxy-3-(Isopropylamino)Propoxy]Phenyl}Ethyl)Carbamate Sulfate (2:1) |
|---|---|
| Synonyms | (±)-[2-[4 |
| Molecular Structure | ![]() |
| Molecular Formula | C32H54N4O12S |
| Molecular Weight | 718.86 |
| CAS Registry Number | 59954-01-7 |
| SMILES | O=S(=O)(O)O.O=C(OC)NCCc1ccc(OCC(O)CNC(C)C)cc1.O=C(OC)NCCc1ccc(OCC(O)CNC(C)C)cc1 |
| InChI | 1S/2C16H26N2O4.H2O4S/c2*1-12(2)18-10-14(19)11-22-15-6-4-13(5-7-15)8-9-17-16(20)21-3;1-5(2,3)4/h2*4-7,12,14,18-19H,8-11H2,1-3H3,(H,17,20);(H2,1,2,3,4) |
| InChIKey | OUXGIOLQOYAZLS-UHFFFAOYSA-N |
| Boiling point | 487°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 248.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2-{4-[2-Hydroxy-3-(Isopropylamino)Propoxy]Phenyl}Ethyl)Carbamate Sulfate (2:1) |