|
CAS#: 59986-40-2 Product: 2-Ethylhexyl 4-(Trifluoromethyl)Benzoate No suppilers available for the product. |
| Name | 2-Ethylhexyl 4-(Trifluoromethyl)Benzoate |
|---|---|
| Synonyms | 2-Ethylhexyl 4-(trifluoromethyl)benzoate #; 4-Trifluoromethylbenzoic acid, 2-ethylhexyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.33 |
| CAS Registry Number | 59986-40-2 |
| SMILES | FC(F)(F)c1ccc(C(=O)OCC(CC)CCCC)cc1 |
| InChI | 1S/C16H21F3O2/c1-3-5-6-12(4-2)11-21-15(20)13-7-9-14(10-8-13)16(17,18)19/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | HIHUOUKCDYVAST-UHFFFAOYSA-N |
| Density | 1.092g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.723°C at 760 mmHg (Cal.) |
| Flash point | 103.406°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylhexyl 4-(Trifluoromethyl)Benzoate |