|
CAS#: 6000-06-2 Product: 1,3,3A,4,7,7alpha-Hexahydro-1,3-Dioxo-4,7-Ethanoisobenzofuran-8-Carboxylic Acid No suppilers available for the product. |
| Name | 1,3,3A,4,7,7alpha-Hexahydro-1,3-Dioxo-4,7-Ethanoisobenzofuran-8-Carboxylic Acid |
|---|---|
| Synonyms | 1,3,3A,4,7,7A-Hexahydro-1,3-Dioxo-4,7-Ethanoisobenzofuran-8-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 |
| CAS Registry Number | 6000-06-2 |
| EINECS | 227-839-7 |
| SMILES | O=C2C1C3C(CC(C1C(O2)=O)C=C3)C(=O)O |
| InChI | 1S/C11H10O5/c12-9(13)6-3-4-1-2-5(6)8-7(4)10(14)16-11(8)15/h1-2,4-8H,3H2,(H,12,13) |
| InChIKey | VJLYGVPKNHTZKM-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.436°C at 760 mmHg (Cal.) |
| Flash point | 198.926°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,3A,4,7,7alpha-Hexahydro-1,3-Dioxo-4,7-Ethanoisobenzofuran-8-Carboxylic Acid |