Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Octahydro-4,7-Methano-1H-Indenetriol |
|---|---|
| Synonyms | Octahydro-4,7-Methano-1H-Indenetriol |
| Molecular Structure |  |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 |
| CAS Registry Number | 60015-25-0 |
| EINECS | 262-023-4 |
| SMILES | C1C2C(C(C1O)(O)O)C3CC2CC3 |
| InChI | 1S/C10H16O3/c11-8-4-7-5-1-2-6(3-5)9(7)10(8,12)13/h5-9,11-13H,1-4H2 |
| InChIKey | MSVYFKULKOQBHT-UHFFFAOYSA-N |
| Density | 1.43g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.086°C at 760 mmHg (Cal.) |
| Flash point | 144.134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-4,7-Methano-1H-Indenetriol |