Online Database of Chemicals from Around the World
|
CAS#: 60077-62-5 Product: Villosol No suppilers available for the product. |
| Name | Villosol |
|---|---|
| Synonyms | Isopatriscabrol; Patriscabrol |
| Molecular Structure |  |
| Molecular Formula | C23H20O7 |
| Molecular Weight | 408.41 |
| CAS Registry Number | 60077-62-5 |
| SMILES | [C@H]2(OC1=CC(=C3C(=C1C2)OC5=C(C3=O)C4=CC(=C(OC)C=C4OC5)OC)O)C(=C)C |
| InChI | 1S/C23H20O7/c1-10(2)14-6-12-16(29-14)7-13(24)21-22(25)20-11-5-17(26-3)18(27-4)8-15(11)28-9-19(20)30-23(12)21/h5,7-8,14,24H,1,6,9H2,2-4H3/t14-/m1/s1 |
| InChIKey | STFNGWNFASVBRR-CQSZACIVSA-N |
| Density | 1.44g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.44°C at 760 mmHg (Cal.) |
| Flash point | 222.558°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Villosol |