|
CAS#: 60093-93-8 Product: 1,1'-[Oxybis(Methyleneoxy)]Bis[2,4,6-Trichlorobenzene] No suppilers available for the product. |
| Name | 1,1'-[Oxybis(Methyleneoxy)]Bis[2,4,6-Trichlorobenzene] |
|---|---|
| Synonyms | Benzene, 1,1'-(Oxybis(Methyleneoxy))Bis(2,4,6-Trichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl6O3 |
| Molecular Weight | 436.93 |
| CAS Registry Number | 60093-93-8 |
| SMILES | C1=C(Cl)C(=C(C=C1Cl)Cl)OCOCOC2=C(Cl)C=C(C=C2Cl)Cl |
| InChI | 1S/C14H8Cl6O3/c15-7-1-9(17)13(10(18)2-7)22-5-21-6-23-14-11(19)3-8(16)4-12(14)20/h1-4H,5-6H2 |
| InChIKey | DJYQPTJGQRXOMR-UHFFFAOYSA-N |
| Density | 1.581g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.748°C at 760 mmHg (Cal.) |
| Flash point | 180.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[Oxybis(Methyleneoxy)]Bis[2,4,6-Trichlorobenzene] |