Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 5-Cholesten-3-One |
|---|---|
| Synonyms | 17-(1,5-Dimethylhexyl)-10,13-Dimethyl-1,2,4,7,8,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-One; .Delta.(Sup5)-Cholestenone; Nsc118979 |
| Molecular Structure |  |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.64 |
| CAS Registry Number | 601-54-7 |
| EINECS | 210-004-6 |
| SMILES | C(C(C4C3(C(C1C(C2(C(=CC1)CC(=O)CC2)C)CC3)CC4)C)C)CCC(C)C |
| InChI | 1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,22-25H,6-8,10-17H2,1-5H3 |
| InChIKey | GGCLNOIGPMGLDB-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.368°C at 760 mmHg (Cal.) |
| Flash point | 200.455°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-Cholesten-3-One |