|
CAS#: 60142-17-8 Product: Dioncophylline A No suppilers available for the product. |
| Name | Dioncophylline A |
|---|---|
| Synonyms | (1R,3R)-7-(4,5-Dimethoxy-2-Methyl-1-Naphthyl)-1,3-Dimethyl-1,2,3,4-Tetrahydroisoquinolin-8-Ol; (1R,3R)-7-(4,5-Dimethoxy-2-Methyl-Naphthalen-1-Yl)-1,3-Dimethyl-1,2,3,4-Tetrahydroisoquinolin-8-Ol; C12336 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 |
| CAS Registry Number | 60142-17-8 |
| SMILES | [C@H]2(C1=C(C(=CC=C1C[C@@H](C)N2)C3=C(C=C(OC)C4=C(OC)C=CC=C34)C)O)C |
| InChI | 1S/C24H27NO3/c1-13-11-20(28-5)23-17(7-6-8-19(23)27-4)21(13)18-10-9-16-12-14(2)25-15(3)22(16)24(18)26/h6-11,14-15,25-26H,12H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | MXIZZLBQRBAZEX-HUUCEWRRSA-N |
| Density | 1.129g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.819°C at 760 mmHg (Cal.) |
| Flash point | 243.381°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dioncophylline A |