|
CAS#: 60165-04-0 Product: 2,6-Dimethyl-4-Nitro-N-(Phenylmethylene)-Benzenamine No suppilers available for the product. |
| Name | 2,6-Dimethyl-4-Nitro-N-(Phenylmethylene)-Benzenamine |
|---|---|
| Synonyms | (2,6-Dimethylphenyl)-(4-Nitrobenzylidene)Amine; Nsc269619 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 |
| CAS Registry Number | 60165-04-0 |
| SMILES | C1=C(C=CC(=C1)C=NC2=C(C=CC=C2C)C)[N+]([O-])=O |
| InChI | 1S/C15H14N2O2/c1-11-4-3-5-12(2)15(11)16-10-13-6-8-14(9-7-13)17(18)19/h3-10H,1-2H3 |
| InChIKey | RDUVHEGEZYBPPZ-UHFFFAOYSA-N |
| Density | 1.128g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.355°C at 760 mmHg (Cal.) |
| Flash point | 197.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dimethyl-4-Nitro-N-(Phenylmethylene)-Benzenamine |