|
CAS#: 6018-53-7 Product: 6-Desoxy-D-Glucosamine No suppilers available for the product. |
| Name | 6-Desoxy-D-Glucosamine |
|---|---|
| Synonyms | (2R,3R,4R,5R)-2-Amino-3,4,5-Trihydroxy-Hexanal; 2-Amino-2,6-Dideoxy-D-Glucose; 6-Desoxy-D-Glucosamine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 |
| CAS Registry Number | 6018-53-7 |
| SMILES | [C@H](O)([C@H](O)[C@H](O)C)[C@@H](N)C=O |
| InChI | 1S/C6H13NO4/c1-3(9)5(10)6(11)4(7)2-8/h2-6,9-11H,7H2,1H3/t3-,4+,5-,6-/m1/s1 |
| InChIKey | NTBYIQWZAVDRHA-JGWLITMVSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.335°C at 760 mmHg (Cal.) |
| Flash point | 207.407°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Desoxy-D-Glucosamine |