|
CAS#: 602-40-4 Product: 10,11-Dihydro-5H-Dibenzo[a,d]Cycloheptene-5-Carboxylic Acid (1R,5S)-Tropan-3alpha-Yl Ester No suppilers available for the product. |
| Name | 10,11-Dihydro-5H-Dibenzo[a,d]Cycloheptene-5-Carboxylic Acid (1R,5S)-Tropan-3alpha-Yl Ester |
|---|---|
| Synonyms | 1Alphah,5Alphah-Tropan-3Alpha-Ol, 10,11-Dihydro-5H-Dibenzo(A,D)Cycloheptene-5-Carboxylate (Ester); 5H-Dibenzo(A,D)Cycloheptene-5-Carboxylic Acid, 10,11-Dihydro-, (3-Endo)-8-Methyl-8-Azabicyclo(3.2.1)Oct-3-Yl Ester; 5H-Dibenzo(A,D)Cycloheptene-5-Carboxylic Acid, 10,11-Dihydro-, 3Alpha-Tropanyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.48 |
| CAS Registry Number | 602-40-4 |
| SMILES | C4(OC(C1C3=C(CCC2=C1C=CC=C2)C=CC=C3)=O)C[C@@H]5N(C)[C@H](C4)CC5 |
| InChI | 1S/C24H27NO2/c1-25-18-12-13-19(25)15-20(14-18)27-24(26)23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+ |
| InChIKey | NAWCPJNPSJBJGQ-PMOLBWCYSA-N |
| Density | 1.203g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.502°C at 760 mmHg (Cal.) |
| Flash point | 146.131°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10,11-Dihydro-5H-Dibenzo[a,d]Cycloheptene-5-Carboxylic Acid (1R,5S)-Tropan-3alpha-Yl Ester |