Online Database of Chemicals from Around the World
|
CAS#: 60218-40-8 Product: 4,6-Dimethyl-N-(3,4,5-trimethoxyphenyl)-2-pyrimidinamine No suppilers available for the product. |
| Name | 4,6-Dimethyl-N-(3,4,5-trimethoxyphenyl)-2-pyrimidinamine |
|---|---|
| Synonyms | 4,6-Dimethyl-N-(3,4,5-Trimethoxyphenyl)-2-Pyrimidinamine; (4,6-Dimethylpyrimidin-2-Yl)-(3,4,5-Trimethoxyphenyl)Amine; 4,6-Dimethyl-1-Amino-3,4,5-Trimethoxyphenylpyrimidine |
| Molecular Structure |  |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 |
| CAS Registry Number | 60218-40-8 |
| SMILES | C1=C(N=C(N=C1C)NC2=CC(=C(C(=C2)OC)OC)OC)C |
| InChI | 1S/C15H19N3O3/c1-9-6-10(2)17-15(16-9)18-11-7-12(19-3)14(21-5)13(8-11)20-4/h6-8H,1-5H3,(H,16,17,18) |
| InChIKey | ODGVVOCHOHMNSJ-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.295°C at 760 mmHg (Cal.) |
| Flash point | 218.873°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dimethyl-N-(3,4,5-trimethoxyphenyl)-2-pyrimidinamine |