|
CAS#: 603106-45-2 Product: 2,5-Dibromophenylalanine No suppilers available for the product. |
| Name | 2,5-Dibromophenylalanine |
|---|---|
| Synonyms | DL-2,5-Bromophenylalanine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9Br2NO2 |
| Molecular Weight | 322.98 |
| CAS Registry Number | 603106-45-2 |
| SMILES | Brc1ccc(Br)cc1CC(C(=O)O)N |
| InChI | 1S/C9H9Br2NO2/c10-6-1-2-7(11)5(3-6)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14) |
| InChIKey | BLPQUKKGXNVOIA-UHFFFAOYSA-N |
| Density | 1.902g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.091°C at 760 mmHg (Cal.) |
| Flash point | 204.84°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dibromophenylalanine |