|
CAS#: 6035-31-0 Product: 2,2'-(2,6-Piperidinediyl)Bis(1-Phenylethanone) No suppilers available for the product. |
| Name | 2,2'-(2,6-Piperidinediyl)Bis(1-Phenylethanone) |
|---|---|
| Synonyms | cis-Norlobelanin; NSC96348 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.41 |
| CAS Registry Number | 6035-31-0 |
| SMILES | O=C(c1ccccc1)CC2NC(CCC2)CC(=O)c3ccccc3 |
| InChI | 1S/C21H23NO2/c23-20(16-8-3-1-4-9-16)14-18-12-7-13-19(22-18)15-21(24)17-10-5-2-6-11-17/h1-6,8-11,18-19,22H,7,12-15H2 |
| InChIKey | OMAMGHBETNHQJC-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 484.087°C at 760 mmHg (Cal.) |
| Flash point | 159.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-(2,6-Piperidinediyl)Bis(1-Phenylethanone) |