|
CAS#: 6036-92-6 Product: N,N-Bis (2-Bromoethyl)-9H-Fluoren-2-Amine No suppilers available for the product. |
| Name | N,N-Bis (2-Bromoethyl)-9H-Fluoren-2-Amine |
|---|---|
| Synonyms | Bis(2-Bromoethyl)-(9H-Fluoren-2-Yl)Amine; 9H-Fluoren-2-Amine, N,N-Bis(2-Bromoethyl)-; Nsc142543 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17Br2N |
| Molecular Weight | 395.14 |
| CAS Registry Number | 6036-92-6 |
| SMILES | C3=C2C1=C(C=CC=C1)CC2=CC(=C3)N(CCBr)CCBr |
| InChI | 1S/C17H17Br2N/c18-7-9-20(10-8-19)15-5-6-17-14(12-15)11-13-3-1-2-4-16(13)17/h1-6,12H,7-11H2 |
| InChIKey | WXJPSQUPGYKDNY-UHFFFAOYSA-N |
| Density | 1.608g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.307°C at 760 mmHg (Cal.) |
| Flash point | 252.143°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N-Bis (2-Bromoethyl)-9H-Fluoren-2-Amine |