|
CAS#: 6038-83-1 Product: 2,3,6-Trichloroindophenol No suppilers available for the product. |
| Name | 2,3,6-Trichloroindophenol |
|---|---|
| Synonyms | 4-(2,3,5-Trichloro-4-Hydroxy-Phenyl)Iminocyclohexa-2,5-Dien-1-One; 4-(2,3,5-Trichloro-4-Hydroxyphenyl)Imino-1-Cyclohexa-2,5-Dienone; 2,3,6-Trichloroindophenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl3NO2 |
| Molecular Weight | 302.54 |
| CAS Registry Number | 6038-83-1 |
| SMILES | C2=C(N=C1C=CC(=O)C=C1)C(=C(Cl)C(=C2Cl)O)Cl |
| InChI | 1S/C12H6Cl3NO2/c13-8-5-9(10(14)11(15)12(8)18)16-6-1-3-7(17)4-2-6/h1-5,18H |
| InChIKey | QTAZYNKIJHHMCG-UHFFFAOYSA-N |
| Density | 1.543g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.692°C at 760 mmHg (Cal.) |
| Flash point | 216.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trichloroindophenol |