|
CAS#: 604-84-2 Product: 9,10-Phenanthrenehydroquinone No suppilers available for the product. |
| Name | 9,10-Phenanthrenehydroquinone |
|---|---|
| Synonyms | 9,10-Dihydroxyphenanthrene; 9,10-Hydroxyphenanthrenequinone; 9,10-Phenanthrenediol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 |
| CAS Registry Number | 604-84-2 |
| SMILES | C1=CC=CC2=C(O)C(=C3C(=C12)C=CC=C3)O |
| InChI | 1S/C14H10O2/c15-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)16/h1-8,15-16H |
| InChIKey | ODUSUXJNDWKJKH-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.834°C at 760 mmHg (Cal.) |
| Flash point | 229.962°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Phenanthrenehydroquinone |