|
CAS#: 60423-21-4 Product: 2-Methoxy-5-(2',3',4'-Trimethoxyphenyl)Tropone No suppilers available for the product. |
| Name | 2-Methoxy-5-(2',3',4'-Trimethoxyphenyl)Tropone |
|---|---|
| Synonyms | 2-Methoxy-5-(2,3,4-Trimethoxyphenyl)-1-Cyclohepta-2,4,6-Trienone; 2,4,6-Cycloheptatrien-1-One, 2-Methoxy-5-(2,3,4-Trimethoxyphenyl)-; 2-Methoxy-5-(2',3',4'-Trimethoxyphenyl)Tropone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 |
| CAS Registry Number | 60423-21-4 |
| SMILES | C1=CC(=C(OC)C(=C1OC)OC)C2=CC=C(OC)C(=O)C=C2 |
| InChI | 1S/C17H18O5/c1-19-14-9-6-11(5-8-13(14)18)12-7-10-15(20-2)17(22-4)16(12)21-3/h5-10H,1-4H3 |
| InChIKey | QIMGSZURBOTPMW-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.83°C at 760 mmHg (Cal.) |
| Flash point | 223.254°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-5-(2',3',4'-Trimethoxyphenyl)Tropone |