| Name | Bis(Oxiranylmethyl) Oxalate |
|---|---|
| Synonyms | Oxalic Acid Bis(2-Oxiranylmethyl) Ester; Oxalic Acid Diglycidyl Ester; Bis(Oxiran-2-Ylmethyl) Ethanedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 |
| CAS Registry Number | 60468-47-5 |
| EINECS | 262-247-2 |
| SMILES | C(C1OC1)OC(C(OCC2OC2)=O)=O |
| InChI | 1S/C8H10O6/c9-7(13-3-5-1-11-5)8(10)14-4-6-2-12-6/h5-6H,1-4H2 |
| InChIKey | UEWVYUPDLTWIHL-UHFFFAOYSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.362°C at 760 mmHg (Cal.) |
| Flash point | 137.423°C (Cal.) |
| (1) | Shuo LiElectronic supplementary information (ESI) available: Characterization of 2 and 3. See DOI: 10.1039/c0mb00339e, Yu Wang, Ji Zhang, Wei-Han Yang, Zhen-Hua Dai, Wen Zhu and Xiao-Qi Yu. Biodegradable cross-linked poly(amino alcohol esters) based on LMW PEI for gene delivery, Mol. Biosyst., 2011, 7, 1254. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Bis(Oxiranylmethyl) Oxalate |