|
CAS#: 60508-74-9 Product: Dimethylammonium 2-(4-Chlorophenoxy)-2-Methylpropionate No suppilers available for the product. |
| Name | Dimethylammonium 2-(4-Chlorophenoxy)-2-Methylpropionate |
|---|---|
| Synonyms | 2-(4-Chlorophenoxy)-2-Methyl-Propanoic Acid; N-Methylmethanamine; 2-(4-Chlorophenoxy)-2-Methyl-Propionic Acid; Dimethylamine; Dimethylammonium 2-(4-Chlorophenoxy)-2-Methylpropionate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 |
| CAS Registry Number | 60508-74-9 |
| EINECS | 262-272-9 |
| SMILES | C1=C(OC(C(=O)O)(C)C)C=CC(=C1)Cl.CNC |
| InChI | 1S/C10H11ClO3.C2H7N/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8;1-3-2/h3-6H,1-2H3,(H,12,13);3H,1-2H3 |
| InChIKey | AIRJXCHSEKKICL-UHFFFAOYSA-N |
| Boiling point | 324.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 149.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylammonium 2-(4-Chlorophenoxy)-2-Methylpropionate |