|
CAS#: 6051-88-3 Product: Naphthoflavone No suppilers available for the product. |
| Name | Naphthoflavone |
|---|---|
| Synonyms | 2-Phenyl-4-Benzo[G]Chromenone; 4H-Naphtho(2,3-B)Pyran-4-One, 2-Phenyl-; Gamma-Naphthoflavone |
| Molecular Structure | ![]() |
| Molecular Formula | C19H12O2 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 6051-88-3 |
| SMILES | C2=C1C=CC=CC1=CC3=C2OC(=CC3=O)C4=CC=CC=C4 |
| InChI | 1S/C19H12O2/c20-17-12-18(13-6-2-1-3-7-13)21-19-11-15-9-5-4-8-14(15)10-16(17)19/h1-12H |
| InChIKey | KUHLNOSGIHMGFS-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.936°C at 760 mmHg (Cal.) |
| Flash point | 215.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Naphthoflavone |