|
CAS#: 6054-50-8 Product: 2,2'-({4-[(4-Amino-2-Methoxyphenyl)Diazenyl]-3-Methylphenyl}Imino)Diethanol No suppilers available for the product. |
| Name | 2,2'-({4-[(4-Amino-2-Methoxyphenyl)Diazenyl]-3-Methylphenyl}Imino)Diethanol |
|---|---|
| Synonyms | Ethanol, |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 |
| CAS Registry Number | 6054-50-8 |
| SMILES | Cc1cc(ccc1N=Nc2ccc(cc2OC)N)N(CCO)CCO |
| InChI | 1S/C18H24N4O3/c1-13-11-15(22(7-9-23)8-10-24)4-6-16(13)20-21-17-5-3-14(19)12-18(17)25-2/h3-6,11-12,23-24H,7-10,19H2,1-2H3 |
| InChIKey | NDLYMLYUXCQTLP-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.386°C at 760 mmHg (Cal.) |
| Flash point | 319.926°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2'-({4-[(4-Amino-2-Methoxyphenyl)Diazenyl]-3-Methylphenyl}Imino)Diethanol |