Online Database of Chemicals from Around the World
|
CAS#: 60548-34-7 Product: N-Allyl-4-Chloro-alpha,beta-Dimethylcinnamamide No suppilers available for the product. |
| Name | N-Allyl-4-Chloro-alpha,beta-Dimethylcinnamamide |
|---|---|
| Synonyms | (E)-N-Allyl-3-(4-Chlorophenyl)-2-Methyl-But-2-Enamide; (E)-N-Allyl-3-(4-Chlorophenyl)-2-Methylbut-2-Enamide; (E)-3-(4-Chlorophenyl)-2-Methyl-N-Prop-2-Enyl-But-2-Enamide |
| Molecular Structure |  |
| Molecular Formula | C14H16ClNO |
| Molecular Weight | 249.74 |
| CAS Registry Number | 60548-34-7 |
| SMILES | C1=C(C(=C(C(=O)NCC=C)\C)/C)C=CC(=C1)Cl |
| InChI | 1S/C14H16ClNO/c1-4-9-16-14(17)11(3)10(2)12-5-7-13(15)8-6-12/h4-8H,1,9H2,2-3H3,(H,16,17)/b11-10+ |
| InChIKey | FNXMXVMYHCIAGR-ZHACJKMWSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 407.503°C at 760 mmHg (Cal.) |
| Flash point | 200.251°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Allyl-4-Chloro-alpha,beta-Dimethylcinnamamide |