|
CAS#: 60550-86-9 Product: N-(9H-Fluoren-2-Yl)Carbamic Acid Phenyl Ester No suppilers available for the product. |
| Name | N-(9H-Fluoren-2-Yl)Carbamic Acid Phenyl Ester |
|---|---|
| Synonyms | N-(9H-Fluoren-2-Yl)Carbamic Acid Phenyl Ester; 4-12-00-03375 (Beilstein Handbook Reference); Brn 3404798 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.34 |
| CAS Registry Number | 60550-86-9 |
| SMILES | C3=C2C1=CC=CC=C1CC2=CC(=C3)NC(OC4=CC=CC=C4)=O |
| InChI | 1S/C20H15NO2/c22-20(23-17-7-2-1-3-8-17)21-16-10-11-19-15(13-16)12-14-6-4-5-9-18(14)19/h1-11,13H,12H2,(H,21,22) |
| InChIKey | HLTNDHVYZZGHPA-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.478°C at 760 mmHg (Cal.) |
| Flash point | 234.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(9H-Fluoren-2-Yl)Carbamic Acid Phenyl Ester |