|
CAS#: 60634-63-1 Product: alpha-(Chloromethyl)Phenethyl Carbamate No suppilers available for the product. |
| Name | alpha-(Chloromethyl)Phenethyl Carbamate |
|---|---|
| Synonyms | [1-(Chloromethyl)-2-Phenyl-Ethyl] Carbamate; Carbamic Acid [1-(Chloromethyl)-2-Phenylethyl] Ester; Carbamic Acid [1-(Benzyl)-2-Chloro-Ethyl] Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 |
| CAS Registry Number | 60634-63-1 |
| SMILES | C1=C(CC(OC(=O)N)CCl)C=CC=C1 |
| InChI | 1S/C10H12ClNO2/c11-7-9(14-10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,13) |
| InChIKey | FIVDTHQNVVFVLG-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.517°C at 760 mmHg (Cal.) |
| Flash point | 186.954°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Chloromethyl)Phenethyl Carbamate |