|
CAS#: 60653-25-0 Product: Orpanoxin No suppilers available for the product. |
| Name | Orpanoxin |
|---|---|
| Synonyms | 3-[5-(4-Chlorophenyl)-2-Furyl]-3-Hydroxy-Propanoic Acid; 3-[5-(4-Chlorophenyl)-2-Furyl]-3-Hydroxypropanoic Acid; 3-[5-(4-Chlorophenyl)-2-Furyl]-3-Hydroxy-Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11ClO4 |
| Molecular Weight | 266.68 |
| CAS Registry Number | 60653-25-0 |
| SMILES | C2=C(C1=CC=C(C=C1)Cl)OC(=C2)C(CC(O)=O)O |
| InChI | 1S/C13H11ClO4/c14-9-3-1-8(2-4-9)11-5-6-12(18-11)10(15)7-13(16)17/h1-6,10,15H,7H2,(H,16,17) |
| InChIKey | YLJRTDTWWRXOFG-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.15°C at 760 mmHg (Cal.) |
| Flash point | 213.342°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Orpanoxin |