|
CAS#: 607-93-2 Product: N-(2,4,6-Tribromophenyl)Acetamide No suppilers available for the product. |
| Name | N-(2,4,6-Tribromophenyl)Acetamide |
|---|---|
| Synonyms | N-(2,4,6-Tribromophenyl)Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6Br3NO |
| Molecular Weight | 371.85 |
| CAS Registry Number | 607-93-2 |
| EINECS | 210-147-4 |
| SMILES | C1=C(C(=C(C=C1Br)Br)NC(=O)C)Br |
| InChI | 1S/C8H6Br3NO/c1-4(13)12-8-6(10)2-5(9)3-7(8)11/h2-3H,1H3,(H,12,13) |
| InChIKey | FQSQCZNNIXYDIH-UHFFFAOYSA-N |
| Density | 2.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.983°C at 760 mmHg (Cal.) |
| Flash point | 203.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,4,6-Tribromophenyl)Acetamide |