|
CAS#: 6072-02-2 Product: alpha-Acetyllysine Methyl Ester No suppilers available for the product. |
| Name | alpha-Acetyllysine Methyl Ester |
|---|---|
| Synonyms | (2R)-2-Acetyl-6-Amino-2-Methylamino-Hexanoic Acid; (2R)-6-Amino-2-Ethanoyl-2-Methylamino-Hexanoic Acid; Alme |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 6072-02-2 |
| SMILES | [C@@](C(=O)O)(NC)(CCCCN)C(=O)C |
| InChI | 1S/C9H18N2O3/c1-7(12)9(11-2,8(13)14)5-3-4-6-10/h11H,3-6,10H2,1-2H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | YSCFPJJTAXKNFR-SECBINFHSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.808°C at 760 mmHg (Cal.) |
| Flash point | 176.244°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Acetyllysine Methyl Ester |